About ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane
ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane (PubChem CID 168883189) has the molecular formula C17H37F3N2
and a molecular weight of 326.49 g/mol. Its IUPAC name is ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane.
Molecular Properties
| Compound Name | ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane |
| PubChem CID | 168883189 |
| Molecular Formula | C17H37F3N2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane |
| SMILES | CC.CC1CC(C(F)(F)F)CCCN1.CCCCC(C)NC |
| InChI | InChI=1S/C8H14F3N.C7H17N.C2H6/c1-6-5-7(8(9,10)11)3-2-4-12-6;1-4-5-6-7(2)8-3;1-2/h6-7,12H,2-5H2,1H3;7-8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | VCIQVQJXNPLBME-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane?
The IUPAC name of ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane (CID 168883189) is ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane.
What is the SMILES notation for ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane?
The canonical SMILES for ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane is CC.CC1CC(C(F)(F)F)CCCN1.CCCCC(C)NC.
What is the InChIKey of ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane?
The InChIKey is VCIQVQJXNPLBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N.C7H17N.C2H6/c1-6-5-7(8(9,10)11)3-2-4-12-6;1-4-5-6-7(2)8-3;1-2/h6-7,12H,2-5H2,1H3;7-8H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane?
ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane has a molecular weight of 326.49 g/mol, XLogP of 5.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylhexan-2-amine;2-methyl-4-(trifluoromethyl)azepane is sourced from PubChem (CID 168883189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).