About 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine
1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine (PubChem CID 168883344) has the molecular formula C12H24FN3
and a molecular weight of 229.34 g/mol. Its IUPAC name is 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine |
| PubChem CID | 168883344 |
| Molecular Formula | C12H24FN3 |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine |
| SMILES | C=C(C1CCC(CN(C)CCF)N1)N(C)C |
| InChI | InChI=1S/C12H24FN3/c1-10(15(2)3)12-6-5-11(14-12)9-16(4)8-7-13/h11-12,14H,1,5-9H2,2-4H3 |
| InChIKey | PENQPPQKZIVLFY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine?
The IUPAC name of 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine (CID 168883344) is 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine.
What is the SMILES notation for 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine?
The canonical SMILES for 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine is C=C(C1CCC(CN(C)CCF)N1)N(C)C.
What is the InChIKey of 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine?
The InChIKey is PENQPPQKZIVLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24FN3/c1-10(15(2)3)12-6-5-11(14-12)9-16(4)8-7-13/h11-12,14H,1,5-9H2,2-4H3.
What are the key properties of 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine?
1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine has a molecular weight of 229.34 g/mol, XLogP of 1.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[[2-fluoroethyl(methyl)amino]methyl]pyrrolidin-2-yl]-N,N-dimethylethenamine is sourced from PubChem (CID 168883344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).