About N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine
N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine (PubChem CID 168883353) has the molecular formula C18H32FN
and a molecular weight of 281.46 g/mol. Its IUPAC name is N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine.
Molecular Properties
| Compound Name | N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine |
| PubChem CID | 168883353 |
| Molecular Formula | C18H32FN |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine |
| SMILES | C=CC(=C)C(CCN(CC)C1CCCC1)C(F)CCC |
| InChI | InChI=1S/C18H32FN/c1-5-10-18(19)17(15(4)6-2)13-14-20(7-3)16-11-8-9-12-16/h6,16-18H,2,4-5,7-14H2,1,3H3 |
| InChIKey | RWFCNQDLGQWFAN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine?
The IUPAC name of N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine (CID 168883353) is N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine.
What is the SMILES notation for N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine?
The canonical SMILES for N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine is C=CC(=C)C(CCN(CC)C1CCCC1)C(F)CCC.
What is the InChIKey of N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine?
The InChIKey is RWFCNQDLGQWFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32FN/c1-5-10-18(19)17(15(4)6-2)13-14-20(7-3)16-11-8-9-12-16/h6,16-18H,2,4-5,7-14H2,1,3H3.
What are the key properties of N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine?
N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine has a molecular weight of 281.46 g/mol, XLogP of 5.14, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-buta-1,3-dien-2-yl-4-fluoroheptyl)-N-ethylcyclopentanamine is sourced from PubChem (CID 168883353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).