About ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine
ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine (PubChem CID 168883374) has the molecular formula C13H27F3N2
and a molecular weight of 268.37 g/mol. Its IUPAC name is ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine |
| PubChem CID | 168883374 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine |
| SMILES | CC.CC1CNC(CCN(C)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H21F3N2.C2H6/c1-9-7-10(15-8-9)3-5-16(2)6-4-11(12,13)14;1-2/h9-10,15H,3-8H2,1-2H3;1-2H3 |
| InChIKey | GFJCFCQFIGXIRT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine?
The IUPAC name of ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine (CID 168883374) is ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine.
What is the SMILES notation for ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine?
The canonical SMILES for ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine is CC.CC1CNC(CCN(C)CCC(F)(F)F)C1.
What is the InChIKey of ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine?
The InChIKey is GFJCFCQFIGXIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2.C2H6/c1-9-7-10(15-8-9)3-5-16(2)6-4-11(12,13)14;1-2/h9-10,15H,3-8H2,1-2H3;1-2H3.
What are the key properties of ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine?
ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine has a molecular weight of 268.37 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,3,3-trifluoro-N-methyl-N-[2-(4-methylpyrrolidin-2-yl)ethyl]propan-1-amine is sourced from PubChem (CID 168883374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).