C13H27F3N2O — CID 168883457
N-[(3-ethyl-3-methylpyrrolidin-2-yl)methyl]ethanamine;trifluoromethoxyethane (PubChem CID 168883457) has the molecular formula C13H27F3N2O and a molecular weight of 284.37 g/mol. Its IUPAC name is N-[(3-ethyl-3-methylpyrrolidin-2-yl)methyl]ethanamine;trifluoromethoxyethane.
| Compound Name | N-[(3-ethyl-3-methylpyrrolidin-2-yl)methyl]ethanamine;trifluoromethoxyethane |
|---|---|
| PubChem CID | 168883457 |
| Molecular Formula | C13H27F3N2O |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | N-[(3-ethyl-3-methylpyrrolidin-2-yl)methyl]ethanamine;trifluoromethoxyethane |
| SMILES | CCNCC1NCCC1(C)CC.CCOC(F)(F)F |
| InChI | InChI=1S/C10H22N2.C3H5F3O/c1-4-10(3)6-7-12-9(10)8-11-5-2;1-2-7-3(4,5)6/h9,11-12H,4-8H2,1-3H3;2H2,1H3 |
| InChIKey | DTICQZADZKWMCW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |