About ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine
ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine (PubChem CID 168883599) has the molecular formula C13H28F3N3O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine.
Molecular Properties
| Compound Name | ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine |
| PubChem CID | 168883599 |
| Molecular Formula | C13H28F3N3O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine |
| SMILES | CC.CC1CCC(CN(C)CCOC(F)(F)F)N1.NC=O |
| InChI | InChI=1S/C10H19F3N2O.C2H6.CH3NO/c1-8-3-4-9(14-8)7-15(2)5-6-16-10(11,12)13;1-2;2-1-3/h8-9,14H,3-7H2,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | CEWVBTLBVVMNCA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine?
The IUPAC name of ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine (CID 168883599) is ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine.
What is the SMILES notation for ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine?
The canonical SMILES for ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine is CC.CC1CCC(CN(C)CCOC(F)(F)F)N1.NC=O.
What is the InChIKey of ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine?
The InChIKey is CEWVBTLBVVMNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O.C2H6.CH3NO/c1-8-3-4-9(14-8)7-15(2)5-6-16-10(11,12)13;1-2;2-1-3/h8-9,14H,3-7H2,1-2H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine?
ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine has a molecular weight of 315.38 g/mol, XLogP of 1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formamide;N-methyl-N-[(5-methylpyrrolidin-2-yl)methyl]-2-(trifluoromethoxy)ethanamine is sourced from PubChem (CID 168883599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).