C28H49N — CID 168883802
1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-ethylethanimine;ethene;methane (PubChem CID 168883802) has the molecular formula C28H49N and a molecular weight of 399.71 g/mol. Its IUPAC name is 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-ethylethanimine;ethene;methane.
| Compound Name | 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-ethylethanimine;ethene;methane |
|---|---|
| PubChem CID | 168883802 |
| Molecular Formula | C28H49N |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-ethylethanimine;ethene;methane |
| SMILES | C.C=C.C=C/C=C1/CCC2C(CCC3(C)C(/C(C)=N/CC)CCC23)C1(C)CCC |
| InChI | InChI=1S/C25H41N.C2H4.CH4/c1-7-10-19-11-12-20-22-14-13-21(18(4)26-9-3)25(22,6)17-15-23(20)24(19,5)16-8-2;1-2;/h7,10,20-23H,1,8-9,11-17H2,2-6H3;1-2H2;1H4/b19-10-,26-18+;; |
| InChIKey | MUWURJQCDNVRPG-LYHCRLMUSA-N |
| XLogP | 8.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|