C16H20F3N3O6S — CID 168884340
5-[(2R)-2-[[3-(2,2-difluoroethoxy)propylamino]methyl]-4-fluoro-6-hydroxy-2,3-dihydro-1-benzofuran-5-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 168884340) has the molecular formula C16H20F3N3O6S and a molecular weight of 439.41 g/mol. Its IUPAC name is 5-[(2R)-2-[[3-(2,2-difluoroethoxy)propylamino]methyl]-4-fluoro-6-hydroxy-2,3-dihydro-1-benzofuran-5-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(2R)-2-[[3-(2,2-difluoroethoxy)propylamino]methyl]-4-fluoro-6-hydroxy-2,3-dihydro-1-benzofuran-5-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 168884340 |
| Molecular Formula | C16H20F3N3O6S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 5-[(2R)-2-[[3-(2,2-difluoroethoxy)propylamino]methyl]-4-fluoro-6-hydroxy-2,3-dihydro-1-benzofuran-5-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](CNCCCOCC(F)F)O3)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H20F3N3O6S/c17-13(18)8-27-3-1-2-20-6-9-4-10-12(28-9)5-11(23)16(15(10)19)22-7-14(24)21-29(22,25)26/h5,9,13,20,23H,1-4,6-8H2,(H,21,24)/t9-/m1/s1 |
| InChIKey | CHERWQJOEUQHLF-SECBINFHSA-N |
| XLogP | 0.28 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|