C32H38F7N3O6 — CID 168884543
tert-butyl (2R)-4-fluoro-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(2,2,2-trifluoroacetyl)amino]-6-phenylmethoxy-2-[(3,3,3-trifluoropropylamino)methyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 168884543) has the molecular formula C32H38F7N3O6 and a molecular weight of 693.66 g/mol. Its IUPAC name is tert-butyl (2R)-4-fluoro-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(2,2,2-trifluoroacetyl)amino]-6-phenylmethoxy-2-[(3,3,3-trifluoropropylamino)methyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-fluoro-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(2,2,2-trifluoroacetyl)amino]-6-phenylmethoxy-2-[(3,3,3-trifluoropropylamino)methyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 168884543 |
| Molecular Formula | C32H38F7N3O6 |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 693.26 |
| IUPAC Name | tert-butyl (2R)-4-fluoro-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-(2,2,2-trifluoroacetyl)amino]-6-phenylmethoxy-2-[(3,3,3-trifluoropropylamino)methyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CN(C(=O)C(F)(F)F)c1c(OCc2ccccc2)cc2c(c1F)C[C@H](CNCCC(F)(F)F)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H38F7N3O6/c1-29(2,3)47-24(43)17-41(27(44)32(37,38)39)26-23(46-18-19-10-8-7-9-11-19)15-22-21(25(26)33)14-20(16-40-13-12-31(34,35)36)42(22)28(45)48-30(4,5)6/h7-11,15,20,40H,12-14,16-18H2,1-6H3/t20-/m1/s1 |
| InChIKey | ZLTYEYGAAGXZRX-HXUWFJFHSA-N |
| XLogP | 6.85 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|