C25H23ClFN7O2S — CID 168885654
N-[(1S,2R,3R)-3-[6-(1-amino-3-iminoprop-1-enyl)-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]-2-hydroxycyclohexyl]-5-chloro-1,3-thiazole-2-carboxamide (PubChem CID 168885654) has the molecular formula C25H23ClFN7O2S and a molecular weight of 540.02 g/mol. Its IUPAC name is N-[(1S,2R,3R)-3-[6-(1-amino-3-iminoprop-1-enyl)-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]-2-hydroxycyclohexyl]-5-chloro-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(1S,2R,3R)-3-[6-(1-amino-3-iminoprop-1-enyl)-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]-2-hydroxycyclohexyl]-5-chloro-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 168885654 |
| Molecular Formula | C25H23ClFN7O2S |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[(1S,2R,3R)-3-[6-(1-amino-3-iminoprop-1-enyl)-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]-2-hydroxycyclohexyl]-5-chloro-1,3-thiazole-2-carboxamide |
| SMILES | [H]/N=C/C=C(N)c1cc2c(cn1)nc(-c1ccccc1F)n2[C@@H]1CCC[C@H](NC(=O)c2ncc(Cl)s2)[C@H]1O |
| InChI | InChI=1S/C25H23ClFN7O2S/c26-21-12-31-25(37-21)24(36)33-16-6-3-7-19(22(16)35)34-20-10-17(15(29)8-9-28)30-11-18(20)32-23(34)13-4-1-2-5-14(13)27/h1-2,4-5,8-12,16,19,22,28,35H,3,6-7,29H2,(H,33,36)/b15-8?,28-9+/t16-,19+,22+/m0/s1 |
| InChIKey | JGROMCOWEKJUCD-DZYGMECCSA-N |
| XLogP | 4.18 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|