C21H24ClF3N8O2S — CID 168885817
chloromethane;N-[3-[6-(N'-methanimidoylcarbamimidoyl)-2-(trifluoromethoxymethyl)imidazo[4,5-c]pyridin-1-yl]cyclohexyl]-1,3-thiazole-2-carboxamide (PubChem CID 168885817) has the molecular formula C21H24ClF3N8O2S and a molecular weight of 544.99 g/mol. Its IUPAC name is chloromethane;N-[3-[6-(N'-methanimidoylcarbamimidoyl)-2-(trifluoromethoxymethyl)imidazo[4,5-c]pyridin-1-yl]cyclohexyl]-1,3-thiazole-2-carboxamide.
| Compound Name | chloromethane;N-[3-[6-(N'-methanimidoylcarbamimidoyl)-2-(trifluoromethoxymethyl)imidazo[4,5-c]pyridin-1-yl]cyclohexyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 168885817 |
| Molecular Formula | C21H24ClF3N8O2S |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | chloromethane;N-[3-[6-(N'-methanimidoylcarbamimidoyl)-2-(trifluoromethoxymethyl)imidazo[4,5-c]pyridin-1-yl]cyclohexyl]-1,3-thiazole-2-carboxamide |
| SMILES | CCl.[H]/N=C/N=C(\N)c1cc2c(cn1)nc(COC(F)(F)F)n2C1CCCC(NC(=O)c2nccs2)C1 |
| InChI | InChI=1S/C20H21F3N8O2S.CH3Cl/c21-20(22,23)33-9-16-30-14-8-27-13(17(25)28-10-24)7-15(14)31(16)12-3-1-2-11(6-12)29-18(32)19-26-4-5-34-19;1-2/h4-5,7-8,10-12H,1-3,6,9H2,(H,29,32)(H3,24,25,28);1H3 |
| InChIKey | AWCCIEYERHRPAH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|