About tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol
tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol (PubChem CID 168886457) has the molecular formula C13H20F3NO3S
and a molecular weight of 327.37 g/mol. Its IUPAC name is tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol.
Molecular Properties
| Compound Name | tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol |
| PubChem CID | 168886457 |
| Molecular Formula | C13H20F3NO3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(C(F)(F)F)CC1CC2.OS |
| InChI | InChI=1S/C13H18F3NO2.H2OS/c1-12(2,3)19-11(18)17-9-4-5-10(17)7-8(6-9)13(14,15)16;1-2/h6,9-10H,4-5,7H2,1-3H3;1-2H |
| InChIKey | ASDRMBJFIBKVRR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol?
The IUPAC name of tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol (CID 168886457) is tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol.
What is the SMILES notation for tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol?
The canonical SMILES for tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol is CC(C)(C)OC(=O)N1C2C=C(C(F)(F)F)CC1CC2.OS.
What is the InChIKey of tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol?
The InChIKey is ASDRMBJFIBKVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3NO2.H2OS/c1-12(2,3)19-11(18)17-9-4-5-10(17)7-8(6-9)13(14,15)16;1-2/h6,9-10H,4-5,7H2,1-3H3;1-2H.
What are the key properties of tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol?
tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol has a molecular weight of 327.37 g/mol, XLogP of 4.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(trifluoromethyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate;sulfanol is sourced from PubChem (CID 168886457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).