C12H21NO — CID 168886572
1-[(3Z,5Z)-3-methylocta-1,3,5-trien-2-yl]oxypropan-2-amine (PubChem CID 168886572) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[(3Z,5Z)-3-methylocta-1,3,5-trien-2-yl]oxypropan-2-amine.
| Compound Name | 1-[(3Z,5Z)-3-methylocta-1,3,5-trien-2-yl]oxypropan-2-amine |
|---|---|
| PubChem CID | 168886572 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-[(3Z,5Z)-3-methylocta-1,3,5-trien-2-yl]oxypropan-2-amine |
| SMILES | C=C(OCC(C)N)/C(C)=C\C=C/CC |
| InChI | InChI=1S/C12H21NO/c1-5-6-7-8-10(2)12(4)14-9-11(3)13/h6-8,11H,4-5,9,13H2,1-3H3/b7-6-,10-8- |
| InChIKey | WMNIQGXXDRSZBI-INZNQPOWSA-N |
| XLogP | 2.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|