About 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one
4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one (PubChem CID 168887130) has the molecular formula C23H16ClF3N2O2
and a molecular weight of 444.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one |
| PubChem CID | 168887130 |
| Molecular Formula | C23H16ClF3N2O2 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one |
| SMILES | Cc1cc2c(-c3ccc(Cl)cc3)nn(-c3ccc(OC(F)(F)F)cc3)c(=O)c2cc1C |
| InChI | InChI=1S/C23H16ClF3N2O2/c1-13-11-19-20(12-14(13)2)22(30)29(28-21(19)15-3-5-16(24)6-4-15)17-7-9-18(10-8-17)31-23(25,26)27/h3-12H,1-2H3 |
| InChIKey | NFVSEDIGAQPJFG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one?
The IUPAC name of 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one (CID 168887130) is 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one.
What is the SMILES notation for 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one?
The canonical SMILES for 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one is Cc1cc2c(-c3ccc(Cl)cc3)nn(-c3ccc(OC(F)(F)F)cc3)c(=O)c2cc1C.
What is the InChIKey of 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one?
The InChIKey is NFVSEDIGAQPJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16ClF3N2O2/c1-13-11-19-20(12-14(13)2)22(30)29(28-21(19)15-3-5-16(24)6-4-15)17-7-9-18(10-8-17)31-23(25,26)27/h3-12H,1-2H3.
What are the key properties of 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one?
4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one has a molecular weight of 444.84 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-6,7-dimethyl-2-[4-(trifluoromethoxy)phenyl]phthalazin-1-one is sourced from PubChem (CID 168887130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).