About 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one
4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one (PubChem CID 168887142) has the molecular formula C16H12Cl2N2O
and a molecular weight of 319.19 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one |
| PubChem CID | 168887142 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one |
| SMILES | Cc1cc2c(-c3ccc(Cl)c(Cl)c3)n[nH]c(=O)c2cc1C |
| InChI | InChI=1S/C16H12Cl2N2O/c1-8-5-11-12(6-9(8)2)16(21)20-19-15(11)10-3-4-13(17)14(18)7-10/h3-7H,1-2H3,(H,20,21) |
| InChIKey | DPQCTCCDGVRRMA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one?
The IUPAC name of 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one (CID 168887142) is 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one?
The canonical SMILES for 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one is Cc1cc2c(-c3ccc(Cl)c(Cl)c3)n[nH]c(=O)c2cc1C.
What is the InChIKey of 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one?
The InChIKey is DPQCTCCDGVRRMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N2O/c1-8-5-11-12(6-9(8)2)16(21)20-19-15(11)10-3-4-13(17)14(18)7-10/h3-7H,1-2H3,(H,20,21).
What are the key properties of 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one?
4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one has a molecular weight of 319.19 g/mol, XLogP of 4.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-6,7-dimethyl-2H-phthalazin-1-one is sourced from PubChem (CID 168887142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).