About 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one
2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one (PubChem CID 168887158) has the molecular formula C19H15ClN4OS
and a molecular weight of 382.88 g/mol. Its IUPAC name is 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| PubChem CID | 168887158 |
| Molecular Formula | C19H15ClN4OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| SMILES | Nc1nc2c(=O)n(CCc3ccccc3)nc(-c3ccc(Cl)cc3)c2s1 |
| InChI | InChI=1S/C19H15ClN4OS/c20-14-8-6-13(7-9-14)15-17-16(22-19(21)26-17)18(25)24(23-15)11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H2,21,22) |
| InChIKey | YFZGEEBBNKCZAQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one?
The IUPAC name of 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one (CID 168887158) is 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one?
The canonical SMILES for 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one is Nc1nc2c(=O)n(CCc3ccccc3)nc(-c3ccc(Cl)cc3)c2s1.
What is the InChIKey of 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one?
The InChIKey is YFZGEEBBNKCZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4OS/c20-14-8-6-13(7-9-14)15-17-16(22-19(21)26-17)18(25)24(23-15)11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H2,21,22).
What are the key properties of 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one?
2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one has a molecular weight of 382.88 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-(4-chlorophenyl)-5-(2-phenylethyl)-[1,3]thiazolo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 168887158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).