C19H39NO — CID 168888159
6-tert-butyl-1-hydroxy-2,2,3,3,5,5,8,8-octamethylazocane (PubChem CID 168888159) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is 6-tert-butyl-1-hydroxy-2,2,3,3,5,5,8,8-octamethylazocane.
| Compound Name | 6-tert-butyl-1-hydroxy-2,2,3,3,5,5,8,8-octamethylazocane |
|---|---|
| PubChem CID | 168888159 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 6-tert-butyl-1-hydroxy-2,2,3,3,5,5,8,8-octamethylazocane |
| SMILES | CC(C)(C)C1CC(C)(C)N(O)C(C)(C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C19H39NO/c1-15(2,3)14-12-18(8,9)20(21)19(10,11)17(6,7)13-16(14,4)5/h14,21H,12-13H2,1-11H3 |
| InChIKey | XXDLQAVVCBHDNF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |