C29H33F3N6O4S2 — CID 168888551
7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888551) has the molecular formula C29H33F3N6O4S2 and a molecular weight of 650.75 g/mol. Its IUPAC name is 7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888551 |
| Molecular Formula | C29H33F3N6O4S2 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2C[C@@H](C)N[C@@H](C)C2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2COC2)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C29H33F3N6O4S2/c1-4-18-9-19(37-12-16(2)34-17(3)13-37)5-6-22(18)35-28-33-11-21(29(30,31)32)25(36-28)23-10-24-26(43-23)27(39)38(20-14-42-15-20)7-8-44(24,40)41/h5-6,9-11,16-17,20,34H,4,7-8,12-15H2,1-3H3,(H,33,35,36)/t16-,17+ |
| InChIKey | DFPCFMITIMMAOK-CALCHBBNSA-N |
| XLogP | 4.34 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|