C25H25ClF3N5O2S — CID 168888665
2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-(2-methoxyethyl)-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one (PubChem CID 168888665) has the molecular formula C25H25ClF3N5O2S and a molecular weight of 552.02 g/mol. Its IUPAC name is 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-(2-methoxyethyl)-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one.
| Compound Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-(2-methoxyethyl)-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 168888665 |
| Molecular Formula | C25H25ClF3N5O2S |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-(2-methoxyethyl)-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
| SMILES | COCCN1CCCc2sc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C25H25ClF3N5O2S/c1-36-8-7-34-6-2-3-20-16(23(34)35)11-21(37-20)22-17(25(27,28)29)13-31-24(33-22)32-19-10-14-4-5-30-12-15(14)9-18(19)26/h9-11,13,30H,2-8,12H2,1H3,(H,31,32,33) |
| InChIKey | WQWUHTPXCVWZRM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |