C29H31F3N6O4S2 — CID 168888666
7-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888666) has the molecular formula C29H31F3N6O4S2 and a molecular weight of 648.73 g/mol. Its IUPAC name is 7-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888666 |
| Molecular Formula | C29H31F3N6O4S2 |
| Molecular Weight | 648.73 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | 7-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2CC3CCC(C2)N3)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2COC2)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C29H31F3N6O4S2/c1-2-16-9-19(37-12-17-3-4-18(13-37)34-17)5-6-22(16)35-28-33-11-21(29(30,31)32)25(36-28)23-10-24-26(43-23)27(39)38(20-14-42-15-20)7-8-44(24,40)41/h5-6,9-11,17-18,20,34H,2-4,7-8,12-15H2,1H3,(H,33,35,36) |
| InChIKey | PYTPWBZDRHUBQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|