C21H18ClF3N4O3S2 — CID 168888704
7-chloro-N-[4-(1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 168888704) has the molecular formula C21H18ClF3N4O3S2 and a molecular weight of 530.98 g/mol. Its IUPAC name is 7-chloro-N-[4-(1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | 7-chloro-N-[4-(1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 168888704 |
| Molecular Formula | C21H18ClF3N4O3S2 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 7-chloro-N-[4-(1,1-dioxo-3,5-dihydro-2H-thieno[3,2-e][1,4]oxathiepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | O=S1(=O)CCOCc2sc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H18ClF3N4O3S2/c22-14-5-12-8-26-2-1-11(12)6-15(14)28-20-27-9-13(21(23,24)25)19(29-20)16-7-18-17(33-16)10-32-3-4-34(18,30)31/h5-7,9,26H,1-4,8,10H2,(H,27,28,29) |
| InChIKey | LEWAIDHCENAUII-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |