C28H29F3N6O3S2 — CID 168888727
4-cyclopropyl-7-[2-[4-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888727) has the molecular formula C28H29F3N6O3S2 and a molecular weight of 618.71 g/mol. Its IUPAC name is 4-cyclopropyl-7-[2-[4-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 4-cyclopropyl-7-[2-[4-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888727 |
| Molecular Formula | C28H29F3N6O3S2 |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 4-cyclopropyl-7-[2-[4-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2C[C@@H]3C[C@H]2CN3)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2CC2)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C28H29F3N6O3S2/c1-2-15-9-18(37-14-16-10-19(37)12-32-16)5-6-21(15)34-27-33-13-20(28(29,30)31)24(35-27)22-11-23-25(41-22)26(38)36(17-3-4-17)7-8-42(23,39)40/h5-6,9,11,13,16-17,19,32H,2-4,7-8,10,12,14H2,1H3,(H,33,34,35)/t16-,19-/m0/s1 |
| InChIKey | SQRMNPFDIRRNDY-LPHOPBHVSA-N |
| XLogP | 4.47 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |