C26H26F3N5O3S2 — CID 168888734
7-[2-[(4-cyclopropyl-2-ethyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888734) has the molecular formula C26H26F3N5O3S2 and a molecular weight of 577.65 g/mol. Its IUPAC name is 7-[2-[(4-cyclopropyl-2-ethyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[(4-cyclopropyl-2-ethyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888734 |
| Molecular Formula | C26H26F3N5O3S2 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 7-[2-[(4-cyclopropyl-2-ethyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCN1Cc2ccc(Nc3ncc(C(F)(F)F)c(-c4cc5c(s4)C(=O)N(C)CCS5(=O)=O)n3)c(C3CC3)c2C1 |
| InChI | InChI=1S/C26H26F3N5O3S2/c1-3-34-12-15-6-7-18(21(14-4-5-14)16(15)13-34)31-25-30-11-17(26(27,28)29)22(32-25)19-10-20-23(38-19)24(35)33(2)8-9-39(20,36)37/h6-7,10-11,14H,3-5,8-9,12-13H2,1-2H3,(H,30,31,32) |
| InChIKey | IOUOGTORDXMWDO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |