C23H23F3N6OS — CID 168888751
7-[2-[(6-ethyl-2-methyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one (PubChem CID 168888751) has the molecular formula C23H23F3N6OS and a molecular weight of 488.54 g/mol. Its IUPAC name is 7-[2-[(6-ethyl-2-methyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one.
| Compound Name | 7-[2-[(6-ethyl-2-methyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 168888751 |
| Molecular Formula | C23H23F3N6OS |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 7-[2-[(6-ethyl-2-methyl-1,3-dihydroisoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one |
| SMILES | CCc1cc2c(cc1Nc1ncc(C(F)(F)F)c(-c3cc4c(s3)NCCNC4=O)n1)CN(C)C2 |
| InChI | InChI=1S/C23H23F3N6OS/c1-3-12-6-13-10-32(2)11-14(13)7-17(12)30-22-29-9-16(23(24,25)26)19(31-22)18-8-15-20(33)27-4-5-28-21(15)34-18/h6-9,28H,3-5,10-11H2,1-2H3,(H,27,33)(H,29,30,31) |
| InChIKey | JWUIDPAFXNJZLM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |