C29H33F3N6O3S2 — CID 168888803
4-cyclopropyl-7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888803) has the molecular formula C29H33F3N6O3S2 and a molecular weight of 634.75 g/mol. Its IUPAC name is 4-cyclopropyl-7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 4-cyclopropyl-7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888803 |
| Molecular Formula | C29H33F3N6O3S2 |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 4-cyclopropyl-7-[2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2C[C@@H](C)N[C@@H](C)C2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2CC2)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C29H33F3N6O3S2/c1-4-18-11-20(37-14-16(2)34-17(3)15-37)7-8-22(18)35-28-33-13-21(29(30,31)32)25(36-28)23-12-24-26(42-23)27(39)38(19-5-6-19)9-10-43(24,40)41/h7-8,11-13,16-17,19,34H,4-6,9-10,14-15H2,1-3H3,(H,33,35,36)/t16-,17+ |
| InChIKey | UJUQUBNSCHSGCB-CALCHBBNSA-N |
| XLogP | 5.11 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|