C22H19ClF3N5OS — CID 168889117
2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-methyl-6,7-dihydrothieno[3,2-c]pyridin-4-one (PubChem CID 168889117) has the molecular formula C22H19ClF3N5OS and a molecular weight of 493.94 g/mol. Its IUPAC name is 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-methyl-6,7-dihydrothieno[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-methyl-6,7-dihydrothieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 168889117 |
| Molecular Formula | C22H19ClF3N5OS |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-methyl-6,7-dihydrothieno[3,2-c]pyridin-4-one |
| SMILES | CN1CCc2sc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C22H19ClF3N5OS/c1-31-5-3-17-13(20(31)32)8-18(33-17)19-14(22(24,25)26)10-28-21(30-19)29-16-7-11-2-4-27-9-12(11)6-15(16)23/h6-8,10,27H,2-5,9H2,1H3,(H,28,29,30) |
| InChIKey | MWVCQLIZRXYSNE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |