C23H23ClF3N5O4S3 — CID 168889153
7-chloro-N-[4-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methylsulfonylthiophen-2-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 168889153) has the molecular formula C23H23ClF3N5O4S3 and a molecular weight of 622.12 g/mol. Its IUPAC name is 7-chloro-N-[4-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methylsulfonylthiophen-2-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | 7-chloro-N-[4-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methylsulfonylthiophen-2-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 168889153 |
| Molecular Formula | C23H23ClF3N5O4S3 |
| Molecular Weight | 622.12 g/mol |
| Exact Mass | 621.06 |
| IUPAC Name | 7-chloro-N-[4-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methylsulfonylthiophen-2-yl]-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | CS(=O)(=O)c1cc(-c2nc(Nc3cc4c(cc3Cl)CNCC4)ncc2C(F)(F)F)sc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C23H23ClF3N5O4S3/c1-38(33,34)19-10-18(37-21(19)32-4-6-39(35,36)7-5-32)20-15(23(25,26)27)12-29-22(31-20)30-17-9-13-2-3-28-11-14(13)8-16(17)24/h8-10,12,28H,2-7,11H2,1H3,(H,29,30,31) |
| InChIKey | YABUPHBEXQBUQP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |