About 1-(azetidin-3-yl)-3,4-dimethylpyrazole
1-(azetidin-3-yl)-3,4-dimethylpyrazole (PubChem CID 168889402) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-3,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-3,4-dimethylpyrazole |
| PubChem CID | 168889402 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-(azetidin-3-yl)-3,4-dimethylpyrazole |
| SMILES | Cc1cn(C2CNC2)nc1C |
| InChI | InChI=1S/C8H13N3/c1-6-5-11(10-7(6)2)8-3-9-4-8/h5,8-9H,3-4H2,1-2H3 |
| InChIKey | MCKJRFKVWXPWCA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azetidin-3-yl)-3,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-3,4-dimethylpyrazole?
The IUPAC name of 1-(azetidin-3-yl)-3,4-dimethylpyrazole (CID 168889402) is 1-(azetidin-3-yl)-3,4-dimethylpyrazole.
What is the SMILES notation for 1-(azetidin-3-yl)-3,4-dimethylpyrazole?
The canonical SMILES for 1-(azetidin-3-yl)-3,4-dimethylpyrazole is Cc1cn(C2CNC2)nc1C.
What is the InChIKey of 1-(azetidin-3-yl)-3,4-dimethylpyrazole?
The InChIKey is MCKJRFKVWXPWCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-5-11(10-7(6)2)8-3-9-4-8/h5,8-9H,3-4H2,1-2H3.
What are the key properties of 1-(azetidin-3-yl)-3,4-dimethylpyrazole?
1-(azetidin-3-yl)-3,4-dimethylpyrazole has a molecular weight of 151.21 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-3,4-dimethylpyrazole is sourced from PubChem (CID 168889402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).