C23H21ClF3N5OS — CID 168889516
2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-ethyl-6,7-dihydrothieno[3,2-c]pyridin-4-one (PubChem CID 168889516) has the molecular formula C23H21ClF3N5OS and a molecular weight of 507.97 g/mol. Its IUPAC name is 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-ethyl-6,7-dihydrothieno[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-ethyl-6,7-dihydrothieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 168889516 |
| Molecular Formula | C23H21ClF3N5OS |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-5-ethyl-6,7-dihydrothieno[3,2-c]pyridin-4-one |
| SMILES | CCN1CCc2sc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C23H21ClF3N5OS/c1-2-32-6-4-18-14(21(32)33)9-19(34-18)20-15(23(25,26)27)11-29-22(31-20)30-17-8-12-3-5-28-10-13(12)7-16(17)24/h7-9,11,28H,2-6,10H2,1H3,(H,29,30,31) |
| InChIKey | RHYJTKUEJMWRTA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |