C21H17ClF3N5OS — CID 168889641
2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 168889641) has the molecular formula C21H17ClF3N5OS and a molecular weight of 479.92 g/mol. Its IUPAC name is 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 168889641 |
| Molecular Formula | C21H17ClF3N5OS |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2-[2-[(7-chloro-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2sc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H17ClF3N5OS/c22-14-5-11-8-26-3-1-10(11)6-15(14)29-20-28-9-13(21(23,24)25)18(30-20)17-7-12-16(32-17)2-4-27-19(12)31/h5-7,9,26H,1-4,8H2,(H,27,31)(H,28,29,30) |
| InChIKey | CPSXTXJUYPXYJG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |