C26H33NO7 — CID 168890043
2-nitrooxyethyl 4-[1-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate (PubChem CID 168890043) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-nitrooxyethyl 4-[1-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate.
| Compound Name | 2-nitrooxyethyl 4-[1-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
|---|---|
| PubChem CID | 168890043 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 2-nitrooxyethyl 4-[1-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
| SMILES | CC#CCC(C)C(O)/C=C/C1CCC2Oc3c(CCCC(=O)OCCO[N+](=O)[O-])cccc3C12 |
| InChI | InChI=1S/C26H33NO7/c1-3-4-7-18(2)22(28)14-12-19-13-15-23-25(19)21-10-5-8-20(26(21)34-23)9-6-11-24(29)32-16-17-33-27(30)31/h5,8,10,12,14,18-19,22-23,25,28H,6-7,9,11,13,15-17H2,1-2H3/b14-12+ |
| InChIKey | FGUVLRATJDCLCJ-WYMLVPIESA-N |
| XLogP | 3.98 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|