C22H31N5OS2 — CID 168890493
ethane;2-(1-phenylpyrazol-4-yl)-N-propyl-N-sulfanyl-1,3-thiazole-4-carboxamide;pyrrolidine (PubChem CID 168890493) has the molecular formula C22H31N5OS2 and a molecular weight of 445.66 g/mol. Its IUPAC name is ethane;2-(1-phenylpyrazol-4-yl)-N-propyl-N-sulfanyl-1,3-thiazole-4-carboxamide;pyrrolidine.
| Compound Name | ethane;2-(1-phenylpyrazol-4-yl)-N-propyl-N-sulfanyl-1,3-thiazole-4-carboxamide;pyrrolidine |
|---|---|
| PubChem CID | 168890493 |
| Molecular Formula | C22H31N5OS2 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethane;2-(1-phenylpyrazol-4-yl)-N-propyl-N-sulfanyl-1,3-thiazole-4-carboxamide;pyrrolidine |
| SMILES | C1CCNC1.CC.CCCN(S)C(=O)c1csc(-c2cnn(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C16H16N4OS2.C4H9N.C2H6/c1-2-8-20(22)16(21)14-11-23-15(18-14)12-9-17-19(10-12)13-6-4-3-5-7-13;1-2-4-5-3-1;1-2/h3-7,9-11,22H,2,8H2,1H3;5H,1-4H2;1-2H3 |
| InChIKey | BHRPTDHEQWYBSW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|