About 4-acetyloxynonanoic acid
4-acetyloxynonanoic acid (PubChem CID 168891082) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-acetyloxynonanoic acid.
Molecular Properties
| Compound Name | 4-acetyloxynonanoic acid |
| PubChem CID | 168891082 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-acetyloxynonanoic acid |
| SMILES | CCCCCC(CCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C11H20O4/c1-3-4-5-6-10(15-9(2)12)7-8-11(13)14/h10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | QKKVDNDENQGFBK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyloxynonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyloxynonanoic acid?
The IUPAC name of 4-acetyloxynonanoic acid (CID 168891082) is 4-acetyloxynonanoic acid.
What is the SMILES notation for 4-acetyloxynonanoic acid?
The canonical SMILES for 4-acetyloxynonanoic acid is CCCCCC(CCC(=O)O)OC(C)=O.
What is the InChIKey of 4-acetyloxynonanoic acid?
The InChIKey is QKKVDNDENQGFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-4-5-6-10(15-9(2)12)7-8-11(13)14/h10H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 4-acetyloxynonanoic acid?
4-acetyloxynonanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyloxynonanoic acid is sourced from PubChem (CID 168891082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).