C29H45FN4O6 — CID 168891474
tert-butyl (2S)-2-[(2R)-6-[N'-[4-(aminomethyl)-4-fluorocyclohexyl]carbamimidoyl]-3,4-dihydro-2H-chromen-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate (PubChem CID 168891474) has the molecular formula C29H45FN4O6 and a molecular weight of 564.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-6-[N'-[4-(aminomethyl)-4-fluorocyclohexyl]carbamimidoyl]-3,4-dihydro-2H-chromen-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate.
| Compound Name | tert-butyl (2S)-2-[(2R)-6-[N'-[4-(aminomethyl)-4-fluorocyclohexyl]carbamimidoyl]-3,4-dihydro-2H-chromen-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
|---|---|
| PubChem CID | 168891474 |
| Molecular Formula | C29H45FN4O6 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-6-[N'-[4-(aminomethyl)-4-fluorocyclohexyl]carbamimidoyl]-3,4-dihydro-2H-chromen-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)NO[C@](C)(C(=O)OC(C)(C)C)[C@H]1CCc2cc(/C(N)=N/C3CCC(F)(CN)CC3)ccc2O1 |
| InChI | InChI=1S/C29H45FN4O6/c1-26(2,3)38-24(35)28(7,40-34-25(36)39-27(4,5)6)22-11-9-18-16-19(8-10-21(18)37-22)23(32)33-20-12-14-29(30,17-31)15-13-20/h8,10,16,20,22H,9,11-15,17,31H2,1-7H3,(H2,32,33)(H,34,36)/t20?,22-,28+,29?/m1/s1 |
| InChIKey | SRQRXOIDHQYYOH-HYZAHUJUSA-N |
| XLogP | 4.25 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|