C27H42N4O6 — CID 168891676
tert-butyl 4-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]piperidine-1-carboxylate (PubChem CID 168891676) has the molecular formula C27H42N4O6 and a molecular weight of 518.66 g/mol. Its IUPAC name is tert-butyl 4-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168891676 |
| Molecular Formula | C27H42N4O6 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | tert-butyl 4-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]piperidine-1-carboxylate |
| SMILES | CC(ONC(=O)OC(C)(C)C)C1CCc2cc(/C(N)=N/C3CCN(C(=O)OC(C)(C)C)CC3)ccc2O1 |
| InChI | InChI=1S/C27H42N4O6/c1-17(37-30-24(32)35-26(2,3)4)21-10-8-18-16-19(9-11-22(18)34-21)23(28)29-20-12-14-31(15-13-20)25(33)36-27(5,6)7/h9,11,16-17,20-21H,8,10,12-15H2,1-7H3,(H2,28,29)(H,30,32) |
| InChIKey | WCLVRIJEJJRUDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|