C26H40N4O6 — CID 168891696
tert-butyl N-[3-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]cyclobutyl]carbamate (PubChem CID 168891696) has the molecular formula C26H40N4O6 and a molecular weight of 504.63 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 168891696 |
| Molecular Formula | C26H40N4O6 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | tert-butyl N-[3-[[amino-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl]-3,4-dihydro-2H-chromen-6-yl]methylidene]amino]cyclobutyl]carbamate |
| SMILES | CC(ONC(=O)OC(C)(C)C)C1CCc2cc(/C(N)=N/C3CC(NC(=O)OC(C)(C)C)C3)ccc2O1 |
| InChI | InChI=1S/C26H40N4O6/c1-15(36-30-24(32)35-26(5,6)7)20-10-8-16-12-17(9-11-21(16)33-20)22(27)28-18-13-19(14-18)29-23(31)34-25(2,3)4/h9,11-12,15,18-20H,8,10,13-14H2,1-7H3,(H2,27,28)(H,29,31)(H,30,32) |
| InChIKey | VYIBYVKQIRSUBU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|