C25H24F2N4O3 — CID 168892721
2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-N-(2,5-difluorophenyl)-4-methylpentanamide (PubChem CID 168892721) has the molecular formula C25H24F2N4O3 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-N-(2,5-difluorophenyl)-4-methylpentanamide.
| Compound Name | 2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-N-(2,5-difluorophenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 168892721 |
| Molecular Formula | C25H24F2N4O3 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-N-(2,5-difluorophenyl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)Nc1cc(F)ccc1F)C(=O)N1C[C@]2(CC1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H24F2N4O3/c1-14(2)9-17(22(32)29-21-10-15(26)7-8-19(21)27)23(33)31-13-25(11-16(31)12-28)18-5-3-4-6-20(18)30-24(25)34/h3-8,10,14,16-17H,9,11,13H2,1-2H3,(H,29,32)(H,30,34)/t16?,17?,25-/m0/s1 |
| InChIKey | HVIFYUVEQXDUPN-SBSMMSGMSA-N |
| XLogP | 3.58 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|