About 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide
4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide (PubChem CID 168892750) has the molecular formula C20H23N3O2S
and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide.
Molecular Properties
| Compound Name | 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide |
| PubChem CID | 168892750 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide |
| SMILES | Cc1ccc(S(=O)N2CC(C)CC2C#N)cc1.O=CNc1ccccc1 |
| InChI | InChI=1S/C13H16N2OS.C7H7NO/c1-10-3-5-13(6-4-10)17(16)15-9-11(2)7-12(15)8-14;9-6-8-7-4-2-1-3-5-7/h3-6,11-12H,7,9H2,1-2H3;1-6H,(H,8,9) |
| InChIKey | PPMLJDRTHNAYEF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide?
The IUPAC name of 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide (CID 168892750) is 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide.
What is the SMILES notation for 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide?
The canonical SMILES for 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide is Cc1ccc(S(=O)N2CC(C)CC2C#N)cc1.O=CNc1ccccc1.
What is the InChIKey of 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide?
The InChIKey is PPMLJDRTHNAYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS.C7H7NO/c1-10-3-5-13(6-4-10)17(16)15-9-11(2)7-12(15)8-14;9-6-8-7-4-2-1-3-5-7/h3-6,11-12H,7,9H2,1-2H3;1-6H,(H,8,9).
What are the key properties of 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide?
4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide has a molecular weight of 369.49 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(4-methylphenyl)sulfinylpyrrolidine-2-carbonitrile;N-phenylformamide is sourced from PubChem (CID 168892750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).