About 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane
5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane (PubChem CID 168893784) has the molecular formula C12H18BrN3
and a molecular weight of 284.20 g/mol. Its IUPAC name is 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane.
Molecular Properties
| Compound Name | 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane |
| PubChem CID | 168893784 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane |
| SMILES | C1CCCCC1.[H]/N=C/n1cc(Br)cc/c1=N\[H] |
| InChI | InChI=1S/C6H6BrN3.C6H12/c7-5-1-2-6(9)10(3-5)4-8;1-2-4-6-5-3-1/h1-4,8-9H;1-6H2/b8-4+,9-6+; |
| InChIKey | NNPXKLCWLCOVCN-HQSPKJHHSA-N |
| XLogP | 3.53 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane?
The IUPAC name of 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane (CID 168893784) is 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane.
What is the SMILES notation for 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane?
The canonical SMILES for 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane is C1CCCCC1.[H]/N=C/n1cc(Br)cc/c1=N\[H].
What is the InChIKey of 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane?
The InChIKey is NNPXKLCWLCOVCN-HQSPKJHHSA-N. The full InChI is InChI=1S/C6H6BrN3.C6H12/c7-5-1-2-6(9)10(3-5)4-8;1-2-4-6-5-3-1/h1-4,8-9H;1-6H2/b8-4+,9-6+;.
What are the key properties of 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane?
5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane has a molecular weight of 284.20 g/mol, XLogP of 3.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methanimidoylpyridin-2-imine;cyclohexane is sourced from PubChem (CID 168893784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).