C17H24N4O2 — CID 168893905
tert-butyl N-[(1R,3S)-3-imidazo[1,5-a]pyrimidin-6-ylcyclohexyl]carbamate (PubChem CID 168893905) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-imidazo[1,5-a]pyrimidin-6-ylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-imidazo[1,5-a]pyrimidin-6-ylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 168893905 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-imidazo[1,5-a]pyrimidin-6-ylcyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](c2ncc3ncccn23)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)20-13-7-4-6-12(10-13)15-19-11-14-18-8-5-9-21(14)15/h5,8-9,11-13H,4,6-7,10H2,1-3H3,(H,20,22)/t12-,13+/m0/s1 |
| InChIKey | CNWQQOACXQXQOS-QWHCGFSZSA-N |
| XLogP | 3.28 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |