About 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane
6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane (PubChem CID 168893975) has the molecular formula C14H24BrN3
and a molecular weight of 314.27 g/mol. Its IUPAC name is 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane.
Molecular Properties
| Compound Name | 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane |
| PubChem CID | 168893975 |
| Molecular Formula | C14H24BrN3 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane |
| SMILES | Brc1ccc2nncn2c1.CC.CCCCCC |
| InChI | InChI=1S/C6H4BrN3.C6H14.C2H6/c7-5-1-2-6-9-8-4-10(6)3-5;1-3-5-6-4-2;1-2/h1-4H;3-6H2,1-2H3;1-2H3 |
| InChIKey | PXWFQYYGTKUYAY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane?
The IUPAC name of 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane (CID 168893975) is 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane.
What is the SMILES notation for 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane?
The canonical SMILES for 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane is Brc1ccc2nncn2c1.CC.CCCCCC.
What is the InChIKey of 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane?
The InChIKey is PXWFQYYGTKUYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3.C6H14.C2H6/c7-5-1-2-6-9-8-4-10(6)3-5;1-3-5-6-4-2;1-2/h1-4H;3-6H2,1-2H3;1-2H3.
What are the key properties of 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane?
6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane has a molecular weight of 314.27 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-[1,2,4]triazolo[4,3-a]pyridine;ethane;hexane is sourced from PubChem (CID 168893975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).