About (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane
(4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane (PubChem CID 168894030) has the molecular formula C16H31N3O
and a molecular weight of 281.44 g/mol. Its IUPAC name is (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane.
Molecular Properties
| Compound Name | (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane |
| PubChem CID | 168894030 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane |
| SMILES | CCCC(C)CCC.[H]/N=c1\cc(OCC)ccn1CN |
| InChI | InChI=1S/C8H13N3O.C8H18/c1-2-12-7-3-4-11(6-9)8(10)5-7;1-4-6-8(3)7-5-2/h3-5,10H,2,6,9H2,1H3;8H,4-7H2,1-3H3/b10-8+; |
| InChIKey | NLPWZFFLBALMLI-VRTOBVRTSA-N |
| XLogP | 3.51 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane?
The IUPAC name of (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane (CID 168894030) is (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane.
What is the SMILES notation for (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane?
The canonical SMILES for (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane is CCCC(C)CCC.[H]/N=c1\cc(OCC)ccn1CN.
What is the InChIKey of (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane?
The InChIKey is NLPWZFFLBALMLI-VRTOBVRTSA-N. The full InChI is InChI=1S/C8H13N3O.C8H18/c1-2-12-7-3-4-11(6-9)8(10)5-7;1-4-6-8(3)7-5-2/h3-5,10H,2,6,9H2,1H3;8H,4-7H2,1-3H3/b10-8+;.
What are the key properties of (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane?
(4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane has a molecular weight of 281.44 g/mol, XLogP of 3.51, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-2-imino-1-pyridinyl)methanamine;4-methylheptane is sourced from PubChem (CID 168894030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).