C16H27N5O2 — CID 168894064
tert-butyl N-[(3R)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-yl]carbamate (PubChem CID 168894064) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 168894064 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(c2nnc3n2CCCC3)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-16(2,3)23-15(22)17-12-7-6-9-20(11-12)14-19-18-13-8-4-5-10-21(13)14/h12H,4-11H2,1-3H3,(H,17,22)/t12-/m1/s1 |
| InChIKey | GFQJBGXBHGBREB-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |