C20H20F3N7O4 — CID 168894214
N-[(1R,3S)-3-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 168894214) has the molecular formula C20H20F3N7O4 and a molecular weight of 479.42 g/mol. Its IUPAC name is N-[(1R,3S)-3-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(1R,3S)-3-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 168894214 |
| Molecular Formula | C20H20F3N7O4 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[(1R,3S)-3-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohexyl]-4-(oxetan-3-yloxy)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nnc([C@H]3CCC[C@@H](Nc4ncc(C(F)(F)F)c(OC5COC5)n4)C3)n2c1 |
| InChI | InChI=1S/C20H20F3N7O4/c21-20(22,23)15-7-24-19(26-18(15)34-14-9-33-10-14)25-12-3-1-2-11(6-12)17-28-27-16-5-4-13(30(31)32)8-29(16)17/h4-5,7-8,11-12,14H,1-3,6,9-10H2,(H,24,25,26)/t11-,12+/m0/s1 |
| InChIKey | QFLAVWXCNWORGW-NWDGAFQWSA-N |
| XLogP | 3.36 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|