About heptane;1-methanimidoyl-4-methoxypyridin-2-imine
heptane;1-methanimidoyl-4-methoxypyridin-2-imine (PubChem CID 168894219) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is heptane;1-methanimidoyl-4-methoxypyridin-2-imine.
Molecular Properties
| Compound Name | heptane;1-methanimidoyl-4-methoxypyridin-2-imine |
| PubChem CID | 168894219 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | heptane;1-methanimidoyl-4-methoxypyridin-2-imine |
| SMILES | CCCCCCC.[H]/N=C/n1ccc(OC)c/c1=N\[H] |
| InChI | InChI=1S/C7H9N3O.C7H16/c1-11-6-2-3-10(5-8)7(9)4-6;1-3-5-7-6-4-2/h2-5,8-9H,1H3;3-7H2,1-2H3/b8-5+,9-7+; |
| InChIKey | LGNAVELKNUKZKI-DRQDVJCFSA-N |
| XLogP | 3.41 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze heptane;1-methanimidoyl-4-methoxypyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;1-methanimidoyl-4-methoxypyridin-2-imine?
The IUPAC name of heptane;1-methanimidoyl-4-methoxypyridin-2-imine (CID 168894219) is heptane;1-methanimidoyl-4-methoxypyridin-2-imine.
What is the SMILES notation for heptane;1-methanimidoyl-4-methoxypyridin-2-imine?
The canonical SMILES for heptane;1-methanimidoyl-4-methoxypyridin-2-imine is CCCCCCC.[H]/N=C/n1ccc(OC)c/c1=N\[H].
What is the InChIKey of heptane;1-methanimidoyl-4-methoxypyridin-2-imine?
The InChIKey is LGNAVELKNUKZKI-DRQDVJCFSA-N. The full InChI is InChI=1S/C7H9N3O.C7H16/c1-11-6-2-3-10(5-8)7(9)4-6;1-3-5-7-6-4-2/h2-5,8-9H,1H3;3-7H2,1-2H3/b8-5+,9-7+;.
What are the key properties of heptane;1-methanimidoyl-4-methoxypyridin-2-imine?
heptane;1-methanimidoyl-4-methoxypyridin-2-imine has a molecular weight of 251.37 g/mol, XLogP of 3.41, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;1-methanimidoyl-4-methoxypyridin-2-imine is sourced from PubChem (CID 168894219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).