About hexane;1-methanimidoyl-4-methoxypiperidin-2-imine
hexane;1-methanimidoyl-4-methoxypiperidin-2-imine (PubChem CID 168894284) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is hexane;1-methanimidoyl-4-methoxypiperidin-2-imine.
Molecular Properties
| Compound Name | hexane;1-methanimidoyl-4-methoxypiperidin-2-imine |
| PubChem CID | 168894284 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | hexane;1-methanimidoyl-4-methoxypiperidin-2-imine |
| SMILES | CCCCCC.[H]/N=C/N1CCC(OC)C/C1=N\[H] |
| InChI | InChI=1S/C7H13N3O.C6H14/c1-11-6-2-3-10(5-8)7(9)4-6;1-3-5-6-4-2/h5-6,8-9H,2-4H2,1H3;3-6H2,1-2H3/b8-5+,9-7+; |
| InChIKey | VEQUOYLOEMAWFA-DRQDVJCFSA-N |
| XLogP | 3.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze hexane;1-methanimidoyl-4-methoxypiperidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;1-methanimidoyl-4-methoxypiperidin-2-imine?
The IUPAC name of hexane;1-methanimidoyl-4-methoxypiperidin-2-imine (CID 168894284) is hexane;1-methanimidoyl-4-methoxypiperidin-2-imine.
What is the SMILES notation for hexane;1-methanimidoyl-4-methoxypiperidin-2-imine?
The canonical SMILES for hexane;1-methanimidoyl-4-methoxypiperidin-2-imine is CCCCCC.[H]/N=C/N1CCC(OC)C/C1=N\[H].
What is the InChIKey of hexane;1-methanimidoyl-4-methoxypiperidin-2-imine?
The InChIKey is VEQUOYLOEMAWFA-DRQDVJCFSA-N. The full InChI is InChI=1S/C7H13N3O.C6H14/c1-11-6-2-3-10(5-8)7(9)4-6;1-3-5-6-4-2/h5-6,8-9H,2-4H2,1H3;3-6H2,1-2H3/b8-5+,9-7+;.
What are the key properties of hexane;1-methanimidoyl-4-methoxypiperidin-2-imine?
hexane;1-methanimidoyl-4-methoxypiperidin-2-imine has a molecular weight of 241.38 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;1-methanimidoyl-4-methoxypiperidin-2-imine is sourced from PubChem (CID 168894284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).