About acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one
acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one (PubChem CID 168894399) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one.
Molecular Properties
| Compound Name | acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one |
| PubChem CID | 168894399 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC.CC#CC(=O)N1CCC(NC)CC1.CC#N |
| InChI | InChI=1S/C10H16N2O.C2H3N.C2H6/c1-3-4-10(13)12-7-5-9(11-2)6-8-12;1-2-3;1-2/h9,11H,5-8H2,1-2H3;1H3;1-2H3 |
| InChIKey | MPRAJJDHOUCAJJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one?
The IUPAC name of acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one (CID 168894399) is acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one.
What is the SMILES notation for acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one?
The canonical SMILES for acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one is CC.CC#CC(=O)N1CCC(NC)CC1.CC#N.
What is the InChIKey of acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one?
The InChIKey is MPRAJJDHOUCAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O.C2H3N.C2H6/c1-3-4-10(13)12-7-5-9(11-2)6-8-12;1-2-3;1-2/h9,11H,5-8H2,1-2H3;1H3;1-2H3.
What are the key properties of acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one?
acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one has a molecular weight of 251.37 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;ethane;1-[4-(methylamino)piperidin-1-yl]but-2-yn-1-one is sourced from PubChem (CID 168894399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).