C15H24ClN3O3 — CID 168894475
4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethylbutan-1-ol;propane-2,2-diol (PubChem CID 168894475) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethylbutan-1-ol;propane-2,2-diol.
| Compound Name | 4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethylbutan-1-ol;propane-2,2-diol |
|---|---|
| PubChem CID | 168894475 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-ethylbutan-1-ol;propane-2,2-diol |
| SMILES | CC(C)(O)O.CCC(CO)CCn1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C12H16ClN3O.C3H8O2/c1-2-9(7-17)3-5-16-6-4-10-11(13)14-8-15-12(10)16;1-3(2,4)5/h4,6,8-9,17H,2-3,5,7H2,1H3;4-5H,1-2H3 |
| InChIKey | QANQTCVBDITBGZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|