C16H27NS — CID 168895131
(2E,4Z,6E)-6-methyl-N-propyl-N-(thietan-2-ylmethyl)octa-2,4,6-trien-3-amine (PubChem CID 168895131) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is (2E,4Z,6E)-6-methyl-N-propyl-N-(thietan-2-ylmethyl)octa-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6E)-6-methyl-N-propyl-N-(thietan-2-ylmethyl)octa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 168895131 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | (2E,4Z,6E)-6-methyl-N-propyl-N-(thietan-2-ylmethyl)octa-2,4,6-trien-3-amine |
| SMILES | C/C=C(C)/C=C\C(=C/C)N(CCC)CC1CCS1 |
| InChI | InChI=1S/C16H27NS/c1-5-11-17(13-16-10-12-18-16)15(7-3)9-8-14(4)6-2/h6-9,16H,5,10-13H2,1-4H3/b9-8-,14-6+,15-7+ |
| InChIKey | BWNGKJLAJNPPCN-MXGHTANRSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|