About 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole
1-methyl-7-propan-2-yl-3a,7a-dihydroindazole (PubChem CID 168895753) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole.
Molecular Properties
| Compound Name | 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole |
| PubChem CID | 168895753 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole |
| SMILES | CC(C)C1=CC=CC2C=NN(C)C12 |
| InChI | InChI=1S/C11H16N2/c1-8(2)10-6-4-5-9-7-12-13(3)11(9)10/h4-9,11H,1-3H3 |
| InChIKey | BFMOAKDSQYPKIU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole?
The IUPAC name of 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole (CID 168895753) is 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole.
What is the SMILES notation for 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole?
The canonical SMILES for 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole is CC(C)C1=CC=CC2C=NN(C)C12.
What is the InChIKey of 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole?
The InChIKey is BFMOAKDSQYPKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8(2)10-6-4-5-9-7-12-13(3)11(9)10/h4-9,11H,1-3H3.
What are the key properties of 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole?
1-methyl-7-propan-2-yl-3a,7a-dihydroindazole has a molecular weight of 176.26 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-propan-2-yl-3a,7a-dihydroindazole is sourced from PubChem (CID 168895753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).